C20H32O2 — CID 14831020
methyl (2R,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dienoate (PubChem CID 14831020) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is methyl (2R,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dienoate.
| Compound Name | methyl (2R,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dienoate |
|---|---|
| PubChem CID | 14831020 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | methyl (2R,3E,5E)-2,6-dimethyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dienoate |
| SMILES | COC(=O)[C@H](C)/C=C/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H32O2/c1-15(9-7-10-17(3)19(21)22-6)12-13-18-16(2)11-8-14-20(18,4)5/h7,9-10,17H,8,11-14H2,1-6H3/b10-7+,15-9+/t17-/m1/s1 |
| InChIKey | AGZLWVWHDVCYDK-UXAJNAOFSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|