C20H26N2 — CID 14831650
(2S,5S)-2,5-dibenzyl-1,4-dimethylpiperazine (PubChem CID 14831650) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2S,5S)-2,5-dibenzyl-1,4-dimethylpiperazine.
| Compound Name | (2S,5S)-2,5-dibenzyl-1,4-dimethylpiperazine |
|---|---|
| PubChem CID | 14831650 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (2S,5S)-2,5-dibenzyl-1,4-dimethylpiperazine |
| SMILES | CN1C[C@H](Cc2ccccc2)N(C)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2/c1-21-15-20(14-18-11-7-4-8-12-18)22(2)16-19(21)13-17-9-5-3-6-10-17/h3-12,19-20H,13-16H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | HGCOAWJFJGNIBD-PMACEKPBSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |