C25H24N6O6 — CID 14831660
benzyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate (PubChem CID 14831660) has the molecular formula C25H24N6O6 and a molecular weight of 504.50 g/mol. Its IUPAC name is benzyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate.
| Compound Name | benzyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 14831660 |
| Molecular Formula | C25H24N6O6 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | benzyl 1-methyl-4-[[1-methyl-4-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]pyrrole-2-carbonyl]amino]pyrrole-2-carboxylate |
| SMILES | Cn1cc(NC(=O)c2cc([N+](=O)[O-])cn2C)cc1C(=O)Nc1cc(C(=O)OCc2ccccc2)n(C)c1 |
| InChI | InChI=1S/C25H24N6O6/c1-28-12-17(26-24(33)21-11-19(31(35)36)14-30(21)3)9-20(28)23(32)27-18-10-22(29(2)13-18)25(34)37-15-16-7-5-4-6-8-16/h4-14H,15H2,1-3H3,(H,26,33)(H,27,32) |
| InChIKey | XDJDPJNOKYBPJU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|