C12H7Cl3O3 — CID 14831726
2-(2,2,2-trichloro-1-hydroxyethyl)naphthalene-1,4-dione (PubChem CID 14831726) has the molecular formula C12H7Cl3O3 and a molecular weight of 305.54 g/mol. Its IUPAC name is 2-(2,2,2-trichloro-1-hydroxyethyl)naphthalene-1,4-dione.
| Compound Name | 2-(2,2,2-trichloro-1-hydroxyethyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 14831726 |
| Molecular Formula | C12H7Cl3O3 |
| Molecular Weight | 305.54 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | 2-(2,2,2-trichloro-1-hydroxyethyl)naphthalene-1,4-dione |
| SMILES | O=C1C=C(C(O)C(Cl)(Cl)Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C12H7Cl3O3/c13-12(14,15)11(18)8-5-9(16)6-3-1-2-4-7(6)10(8)17/h1-5,11,18H |
| InChIKey | GATPOCRLZYGKRG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|