About 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene
2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene (PubChem CID 14832116) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene |
| PubChem CID | 14832116 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene |
| SMILES | CC1(C)CC=CC2(CCCCO2)O1 |
| InChI | InChI=1S/C11H18O2/c1-10(2)6-5-8-11(13-10)7-3-4-9-12-11/h5,8H,3-4,6-7,9H2,1-2H3 |
| InChIKey | WRNWMALYFRLOEW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene?
The IUPAC name of 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene (CID 14832116) is 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene.
What is the SMILES notation for 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene?
The canonical SMILES for 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene is CC1(C)CC=CC2(CCCCO2)O1.
What is the InChIKey of 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene?
The InChIKey is WRNWMALYFRLOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-10(2)6-5-8-11(13-10)7-3-4-9-12-11/h5,8H,3-4,6-7,9H2,1-2H3.
What are the key properties of 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene?
2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene has a molecular weight of 182.26 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene is sourced from PubChem (CID 14832116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).