C22H13F6NO5 — CID 14832329
4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-nitrophenoxy)phenyl]propan-2-yl]benzoic acid (PubChem CID 14832329) has the molecular formula C22H13F6NO5 and a molecular weight of 485.34 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-nitrophenoxy)phenyl]propan-2-yl]benzoic acid.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-nitrophenoxy)phenyl]propan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 14832329 |
| Molecular Formula | C22H13F6NO5 |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-(3-nitrophenoxy)phenyl]propan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(c2ccc(Oc3cccc([N+](=O)[O-])c3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H13F6NO5/c23-21(24,25)20(22(26,27)28,14-6-4-13(5-7-14)19(30)31)15-8-10-17(11-9-15)34-18-3-1-2-16(12-18)29(32)33/h1-12H,(H,30,31) |
| InChIKey | ZWMMCVVJYICTGP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|