About 1-hydroxy-3,5-diphenylpyrazin-2-one
1-hydroxy-3,5-diphenylpyrazin-2-one (PubChem CID 1483278) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-hydroxy-3,5-diphenylpyrazin-2-one.
Molecular Properties
| Compound Name | 1-hydroxy-3,5-diphenylpyrazin-2-one |
| PubChem CID | 1483278 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-hydroxy-3,5-diphenylpyrazin-2-one |
| SMILES | O=c1c(-c2ccccc2)nc(-c2ccccc2)cn1O |
| InChI | InChI=1S/C16H12N2O2/c19-16-15(13-9-5-2-6-10-13)17-14(11-18(16)20)12-7-3-1-4-8-12/h1-11,20H |
| InChIKey | GGLNFNVHMLTOJY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,5-diphenylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,5-diphenylpyrazin-2-one?
The IUPAC name of 1-hydroxy-3,5-diphenylpyrazin-2-one (CID 1483278) is 1-hydroxy-3,5-diphenylpyrazin-2-one.
What is the SMILES notation for 1-hydroxy-3,5-diphenylpyrazin-2-one?
The canonical SMILES for 1-hydroxy-3,5-diphenylpyrazin-2-one is O=c1c(-c2ccccc2)nc(-c2ccccc2)cn1O.
What is the InChIKey of 1-hydroxy-3,5-diphenylpyrazin-2-one?
The InChIKey is GGLNFNVHMLTOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2/c19-16-15(13-9-5-2-6-10-13)17-14(11-18(16)20)12-7-3-1-4-8-12/h1-11,20H.
What are the key properties of 1-hydroxy-3,5-diphenylpyrazin-2-one?
1-hydroxy-3,5-diphenylpyrazin-2-one has a molecular weight of 264.28 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,5-diphenylpyrazin-2-one is sourced from PubChem (CID 1483278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).