About 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate
4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate (PubChem CID 14832799) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate.
Molecular Properties
| Compound Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate |
| PubChem CID | 14832799 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CC1C1CC3OC3C21 |
| InChI | InChI=1S/C13H16O3/c1-2-11(14)15-9-4-6-3-7(9)8-5-10-13(16-10)12(6)8/h2,6-10,12-13H,1,3-5H2 |
| InChIKey | VDBSRPBXFACZJJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate?
The IUPAC name of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate (CID 14832799) is 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate.
What is the SMILES notation for 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate?
The canonical SMILES for 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate is C=CC(=O)OC1CC2CC1C1CC3OC3C21.
What is the InChIKey of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate?
The InChIKey is VDBSRPBXFACZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-2-11(14)15-9-4-6-3-7(9)8-5-10-13(16-10)12(6)8/h2,6-10,12-13H,1,3-5H2.
What are the key properties of 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate?
4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate has a molecular weight of 220.27 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxatetracyclo[6.2.1.02,7.03,5]undecan-9-yl prop-2-enoate is sourced from PubChem (CID 14832799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).