About 1-prop-2-enoxybutan-2-ol
1-prop-2-enoxybutan-2-ol (PubChem CID 14833240) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1-prop-2-enoxybutan-2-ol.
Molecular Properties
| Compound Name | 1-prop-2-enoxybutan-2-ol |
| PubChem CID | 14833240 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 1-prop-2-enoxybutan-2-ol |
| SMILES | C=CCOCC(O)CC |
| InChI | InChI=1S/C7H14O2/c1-3-5-9-6-7(8)4-2/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | MGWNSXLCWPYEHV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enoxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enoxybutan-2-ol?
The IUPAC name of 1-prop-2-enoxybutan-2-ol (CID 14833240) is 1-prop-2-enoxybutan-2-ol.
What is the SMILES notation for 1-prop-2-enoxybutan-2-ol?
The canonical SMILES for 1-prop-2-enoxybutan-2-ol is C=CCOCC(O)CC.
What is the InChIKey of 1-prop-2-enoxybutan-2-ol?
The InChIKey is MGWNSXLCWPYEHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-5-9-6-7(8)4-2/h3,7-8H,1,4-6H2,2H3.
What are the key properties of 1-prop-2-enoxybutan-2-ol?
1-prop-2-enoxybutan-2-ol has a molecular weight of 130.19 g/mol, XLogP of 0.96, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enoxybutan-2-ol is sourced from PubChem (CID 14833240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).