About bis(acetonitrile);tetrachlorotitanium
bis(acetonitrile);tetrachlorotitanium (PubChem CID 14833458) has the molecular formula C4H6Cl4N2Ti
and a molecular weight of 271.79 g/mol. Its IUPAC name is bis(acetonitrile);tetrachlorotitanium.
Molecular Properties
| Compound Name | bis(acetonitrile);tetrachlorotitanium |
| PubChem CID | 14833458 |
| Molecular Formula | C4H6Cl4N2Ti |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 269.88 |
| IUPAC Name | bis(acetonitrile);tetrachlorotitanium |
| SMILES | CC#N.CC#N.Cl[Ti](Cl)(Cl)Cl |
| InChI | InChI=1S/2C2H3N.4ClH.Ti/c2*1-2-3;;;;;/h2*1H3;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | GGTBFQWDDLFSIW-UHFFFAOYSA-J |
| XLogP | 3.82 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(acetonitrile);tetrachlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(acetonitrile);tetrachlorotitanium?
The IUPAC name of bis(acetonitrile);tetrachlorotitanium (CID 14833458) is bis(acetonitrile);tetrachlorotitanium.
What is the SMILES notation for bis(acetonitrile);tetrachlorotitanium?
The canonical SMILES for bis(acetonitrile);tetrachlorotitanium is CC#N.CC#N.Cl[Ti](Cl)(Cl)Cl.
What is the InChIKey of bis(acetonitrile);tetrachlorotitanium?
The InChIKey is GGTBFQWDDLFSIW-UHFFFAOYSA-J. The full InChI is InChI=1S/2C2H3N.4ClH.Ti/c2*1-2-3;;;;;/h2*1H3;4*1H;/q;;;;;;+4/p-4.
What are the key properties of bis(acetonitrile);tetrachlorotitanium?
bis(acetonitrile);tetrachlorotitanium has a molecular weight of 271.79 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(acetonitrile);tetrachlorotitanium is sourced from PubChem (CID 14833458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).