9H-fluoren-9-ylmethyl hydrogen carbonate

C15H12O3 — CID 14833743

IUPAC9H-fluoren-9-ylmethyl hydrogen carbonate
SMILESO=C(O)OCC1c2ccccc2-c2ccccc21
InChIInChI=1S/C15H12O3/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H,16,17)
InChIKeyFGIVSGPRGVABAB-UHFFFAOYSA-N
MW240.26 g/mol
LogP3.49
Rot. Bonds2

About 9H-fluoren-9-ylmethyl hydrogen carbonate

9H-fluoren-9-ylmethyl hydrogen carbonate (PubChem CID 14833743) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl hydrogen carbonate.

Molecular Properties

Compound Name9H-fluoren-9-ylmethyl hydrogen carbonate
PubChem CID14833743
Molecular FormulaC15H12O3
Molecular Weight240.26 g/mol
Exact Mass240.08
IUPAC Name9H-fluoren-9-ylmethyl hydrogen carbonate
SMILESO=C(O)OCC1c2ccccc2-c2ccccc21
InChIInChI=1S/C15H12O3/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H,16,17)
InChIKeyFGIVSGPRGVABAB-UHFFFAOYSA-N
XLogP3.49
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.26
LogP ≤ 53.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 9H-fluoren-9-ylmethyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9H-fluoren-9-ylmethyl hydrogen carbonate?
The IUPAC name of 9H-fluoren-9-ylmethyl hydrogen carbonate (CID 14833743) is 9H-fluoren-9-ylmethyl hydrogen carbonate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl hydrogen carbonate?
The canonical SMILES for 9H-fluoren-9-ylmethyl hydrogen carbonate is O=C(O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl hydrogen carbonate?
The InChIKey is FGIVSGPRGVABAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c16-15(17)18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2,(H,16,17).
What are the key properties of 9H-fluoren-9-ylmethyl hydrogen carbonate?
9H-fluoren-9-ylmethyl hydrogen carbonate has a molecular weight of 240.26 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl hydrogen carbonate is sourced from PubChem (CID 14833743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).