About phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol
phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol (PubChem CID 14833759) has the molecular formula C18H14N2O
and a molecular weight of 274.32 g/mol. Its IUPAC name is phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol.
Molecular Properties
| Compound Name | phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol |
| PubChem CID | 14833759 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol |
| SMILES | OC(c1ccccc1)c1nccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C18H14N2O/c21-18(12-6-2-1-3-7-12)17-16-14(10-11-19-17)13-8-4-5-9-15(13)20-16/h1-11,18,20-21H |
| InChIKey | SNWOAHMLAZAOGH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol?
The IUPAC name of phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol (CID 14833759) is phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol.
What is the SMILES notation for phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol?
The canonical SMILES for phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol is OC(c1ccccc1)c1nccc2c1[nH]c1ccccc12.
What is the InChIKey of phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol?
The InChIKey is SNWOAHMLAZAOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O/c21-18(12-6-2-1-3-7-12)17-16-14(10-11-19-17)13-8-4-5-9-15(13)20-16/h1-11,18,20-21H.
What are the key properties of phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol?
phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol has a molecular weight of 274.32 g/mol, XLogP of 3.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(9H-pyrido[3,4-b]indol-1-yl)methanol is sourced from PubChem (CID 14833759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).