About 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone
2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone (PubChem CID 1483443) has the molecular formula C14H10Cl2O3S
and a molecular weight of 329.20 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone |
| PubChem CID | 1483443 |
| Molecular Formula | C14H10Cl2O3S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O3S/c15-12-7-6-10(8-13(12)16)14(17)9-20(18,19)11-4-2-1-3-5-11/h1-8H,9H2 |
| InChIKey | LZBIUNZNOUZDPA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone?
The IUPAC name of 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone (CID 1483443) is 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone.
What is the SMILES notation for 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone?
The canonical SMILES for 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone is O=C(CS(=O)(=O)c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone?
The InChIKey is LZBIUNZNOUZDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O3S/c15-12-7-6-10(8-13(12)16)14(17)9-20(18,19)11-4-2-1-3-5-11/h1-8H,9H2.
What are the key properties of 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone?
2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone has a molecular weight of 329.20 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-1-(3,4-dichlorophenyl)ethanone is sourced from PubChem (CID 1483443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).