C22H37NO — CID 14834753
N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide (PubChem CID 14834753) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide.
| Compound Name | N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide |
|---|---|
| PubChem CID | 14834753 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]acetamide |
| SMILES | CC(=O)NC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H37NO/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-15-21(5)16-17-23-22(6)24/h10,12,14,16H,7-9,11,13,15,17H2,1-6H3,(H,23,24)/b19-12+,20-14+,21-16+ |
| InChIKey | GSTRVCHSVMEJAJ-RFRQLJORSA-N |
| XLogP | 6.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|