C23H40N2O — CID 14834766
1,1-dimethyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea (PubChem CID 14834766) has the molecular formula C23H40N2O and a molecular weight of 360.59 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea.
| Compound Name | 1,1-dimethyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea |
|---|---|
| PubChem CID | 14834766 |
| Molecular Formula | C23H40N2O |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 1,1-dimethyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]urea |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CNC(=O)N(C)C |
| InChI | InChI=1S/C23H40N2O/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-22(5)17-18-24-23(26)25(6)7/h11,13,15,17H,8-10,12,14,16,18H2,1-7H3,(H,24,26)/b20-13+,21-15+,22-17+ |
| InChIKey | YPZYQCIDHKJSFS-NJFMWZAGSA-N |
| XLogP | 6.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|