C16H13Cl2N3S2 — CID 1483478
3-[(2,6-dichlorophenyl)methylsulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 1483478) has the molecular formula C16H13Cl2N3S2 and a molecular weight of 382.34 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methylsulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2,6-dichlorophenyl)methylsulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1483478 |
| Molecular Formula | C16H13Cl2N3S2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methylsulfanylmethyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CSCc2c(Cl)cccc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C16H13Cl2N3S2/c17-13-7-4-8-14(18)12(13)9-23-10-15-19-20-16(22)21(15)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,20,22) |
| InChIKey | ZHTQOJVKTLITCV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|