C24H37N3O — CID 14834801
N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]imidazole-1-carboxamide (PubChem CID 14834801) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]imidazole-1-carboxamide.
| Compound Name | N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]imidazole-1-carboxamide |
|---|---|
| PubChem CID | 14834801 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | N-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]imidazole-1-carboxamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CNC(=O)n1ccnc1 |
| InChI | InChI=1S/C24H37N3O/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-14-23(5)15-16-26-24(28)27-18-17-25-19-27/h9,11,13,15,17-19H,6-8,10,12,14,16H2,1-5H3,(H,26,28)/b21-11+,22-13+,23-15+ |
| InChIKey | QSUAUFJTUQIEER-FPFQZNTGSA-N |
| XLogP | 6.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|