C23H33N3O2 — CID 14835936
8-[4-[methyl(5,6,7,8-tetrahydroquinolin-7-yl)amino]butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 14835936) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 8-[4-[methyl(5,6,7,8-tetrahydroquinolin-7-yl)amino]butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-[methyl(5,6,7,8-tetrahydroquinolin-7-yl)amino]butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 14835936 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 8-[4-[methyl(5,6,7,8-tetrahydroquinolin-7-yl)amino]butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | CN(CCCCN1C(=O)CC2(CCCC2)CC1=O)C1CCc2cccnc2C1 |
| InChI | InChI=1S/C23H33N3O2/c1-25(19-9-8-18-7-6-12-24-20(18)15-19)13-4-5-14-26-21(27)16-23(17-22(26)28)10-2-3-11-23/h6-7,12,19H,2-5,8-11,13-17H2,1H3 |
| InChIKey | UCPCNLWXGRYMOS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|