C13H20N2O — CID 14835950
N-(4-methyl-5,6,7,8-tetrahydroquinolin-7-yl)-N-propylhydroxylamine (PubChem CID 14835950) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(4-methyl-5,6,7,8-tetrahydroquinolin-7-yl)-N-propylhydroxylamine.
| Compound Name | N-(4-methyl-5,6,7,8-tetrahydroquinolin-7-yl)-N-propylhydroxylamine |
|---|---|
| PubChem CID | 14835950 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-(4-methyl-5,6,7,8-tetrahydroquinolin-7-yl)-N-propylhydroxylamine |
| SMILES | CCCN(O)C1CCc2c(C)ccnc2C1 |
| InChI | InChI=1S/C13H20N2O/c1-3-8-15(16)11-4-5-12-10(2)6-7-14-13(12)9-11/h6-7,11,16H,3-5,8-9H2,1-2H3 |
| InChIKey | FZZZQLZHUMHCOX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|