C13H20N2 — CID 14835957
3-methyl-N-propyl-5,6,7,8-tetrahydroquinolin-7-amine (PubChem CID 14835957) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-methyl-N-propyl-5,6,7,8-tetrahydroquinolin-7-amine.
| Compound Name | 3-methyl-N-propyl-5,6,7,8-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 14835957 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-methyl-N-propyl-5,6,7,8-tetrahydroquinolin-7-amine |
| SMILES | CCCNC1CCc2cc(C)cnc2C1 |
| InChI | InChI=1S/C13H20N2/c1-3-6-14-12-5-4-11-7-10(2)9-15-13(11)8-12/h7,9,12,14H,3-6,8H2,1-2H3 |
| InChIKey | FRCDBQXCKOEDHZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |