C11H16N4O3 — CID 1483601
5-acetyl-1-(4-methylpiperazin-1-yl)pyrimidine-2,4-dione (PubChem CID 1483601) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-acetyl-1-(4-methylpiperazin-1-yl)pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-1-(4-methylpiperazin-1-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1483601 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-acetyl-1-(4-methylpiperazin-1-yl)pyrimidine-2,4-dione |
| SMILES | CC(=O)c1cn(N2CCN(C)CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N4O3/c1-8(16)9-7-15(11(18)12-10(9)17)14-5-3-13(2)4-6-14/h7H,3-6H2,1-2H3,(H,12,17,18) |
| InChIKey | OWJOUBFGQOWSDS-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |