C18H19Cl2N3O3 — CID 14836022
2-[3,5-dichloro-4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-5-methyl-1,3,4-oxadiazole (PubChem CID 14836022) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[3,5-dichloro-4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 14836022 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-[3,5-dichloro-4-[5-(3-methyl-1,2-oxazol-5-yl)pentoxy]phenyl]-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1cc(CCCCCOc2c(Cl)cc(-c3nnc(C)o3)cc2Cl)on1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c1-11-8-14(26-23-11)6-4-3-5-7-24-17-15(19)9-13(10-16(17)20)18-22-21-12(2)25-18/h8-10H,3-7H2,1-2H3 |
| InChIKey | COEUKQUBCYYCFX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|