About 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate
2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate (PubChem CID 1483603) has the molecular formula C15H10F3N3O4
and a molecular weight of 353.26 g/mol. Its IUPAC name is 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate |
| PubChem CID | 1483603 |
| Molecular Formula | C15H10F3N3O4 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate |
| SMILES | N#Cc1cn(CCOC(=O)c2cccc(C(F)(F)F)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H10F3N3O4/c16-15(17,18)11-3-1-2-9(6-11)13(23)25-5-4-21-8-10(7-19)12(22)20-14(21)24/h1-3,6,8H,4-5H2,(H,20,22,24) |
| InChIKey | LIRQVNQODGKWMK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate?
The IUPAC name of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate (CID 1483603) is 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate.
What is the SMILES notation for 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate?
The canonical SMILES for 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate is N#Cc1cn(CCOC(=O)c2cccc(C(F)(F)F)c2)c(=O)[nH]c1=O.
What is the InChIKey of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate?
The InChIKey is LIRQVNQODGKWMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N3O4/c16-15(17,18)11-3-1-2-9(6-11)13(23)25-5-4-21-8-10(7-19)12(22)20-14(21)24/h1-3,6,8H,4-5H2,(H,20,22,24).
What are the key properties of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate?
2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate has a molecular weight of 353.26 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 1483603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).