About 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate
2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate (PubChem CID 1483604) has the molecular formula C15H13N3O4
and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate.
Molecular Properties
| Compound Name | 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate |
| PubChem CID | 1483604 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCn2cc(C#N)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H13N3O4/c1-10-2-4-11(5-3-10)14(20)22-7-6-18-9-12(8-16)13(19)17-15(18)21/h2-5,9H,6-7H2,1H3,(H,17,19,21) |
| InChIKey | CXHHABRILOGBPI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate?
The IUPAC name of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate (CID 1483604) is 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate.
What is the SMILES notation for 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate?
The canonical SMILES for 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate is Cc1ccc(C(=O)OCCn2cc(C#N)c(=O)[nH]c2=O)cc1.
What is the InChIKey of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate?
The InChIKey is CXHHABRILOGBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O4/c1-10-2-4-11(5-3-10)14(20)22-7-6-18-9-12(8-16)13(19)17-15(18)21/h2-5,9H,6-7H2,1H3,(H,17,19,21).
What are the key properties of 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate?
2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate has a molecular weight of 299.29 g/mol, XLogP of 0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyano-2,4-dioxopyrimidin-1-yl)ethyl 4-methylbenzoate is sourced from PubChem (CID 1483604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).