C22H25N3O5 — CID 14836184
8-[4-(11-oxo-3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-12-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 14836184) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 8-[4-(11-oxo-3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-12-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-(11-oxo-3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-12-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 14836184 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 8-[4-(11-oxo-3,9-dioxa-2,12-diazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-12-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCN1C(=O)COc2cccc3onc1c23 |
| InChI | InChI=1S/C22H25N3O5/c26-17-12-22(8-1-2-9-22)13-18(27)24(17)10-3-4-11-25-19(28)14-29-15-6-5-7-16-20(15)21(25)23-30-16/h5-7H,1-4,8-14H2 |
| InChIKey | SKOMNHBPYKOREA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|