About 1-octyl-3-propylurea
1-octyl-3-propylurea (PubChem CID 14836214) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-octyl-3-propylurea.
Molecular Properties
| Compound Name | 1-octyl-3-propylurea |
| PubChem CID | 14836214 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-octyl-3-propylurea |
| SMILES | CCCCCCCCNC(=O)NCCC |
| InChI | InChI=1S/C12H26N2O/c1-3-5-6-7-8-9-11-14-12(15)13-10-4-2/h3-11H2,1-2H3,(H2,13,14,15) |
| InChIKey | YCYDKKOGTYVCIL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octyl-3-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octyl-3-propylurea?
The IUPAC name of 1-octyl-3-propylurea (CID 14836214) is 1-octyl-3-propylurea.
What is the SMILES notation for 1-octyl-3-propylurea?
The canonical SMILES for 1-octyl-3-propylurea is CCCCCCCCNC(=O)NCCC.
What is the InChIKey of 1-octyl-3-propylurea?
The InChIKey is YCYDKKOGTYVCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-3-5-6-7-8-9-11-14-12(15)13-10-4-2/h3-11H2,1-2H3,(H2,13,14,15).
What are the key properties of 1-octyl-3-propylurea?
1-octyl-3-propylurea has a molecular weight of 214.35 g/mol, XLogP of 3.06, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octyl-3-propylurea is sourced from PubChem (CID 14836214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).