About (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine
(E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine (PubChem CID 14836297) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine |
| PubChem CID | 14836297 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine |
| SMILES | CCC/C=C/N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H27N/c1-6-7-8-9-14(10-12(2)3)11-13(4)5/h8-9,12-13H,6-7,10-11H2,1-5H3/b9-8+ |
| InChIKey | IQQMZRVXHDWDGE-CMDGGOBGSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine?
The IUPAC name of (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine (CID 14836297) is (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine.
What is the SMILES notation for (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine?
The canonical SMILES for (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine is CCC/C=C/N(CC(C)C)CC(C)C.
What is the InChIKey of (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine?
The InChIKey is IQQMZRVXHDWDGE-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H27N/c1-6-7-8-9-14(10-12(2)3)11-13(4)5/h8-9,12-13H,6-7,10-11H2,1-5H3/b9-8+.
What are the key properties of (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine?
(E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine has a molecular weight of 197.37 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-bis(2-methylpropyl)pent-1-en-1-amine is sourced from PubChem (CID 14836297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).