C19H24N2 — CID 14836489
6-N-(3-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine (PubChem CID 14836489) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 6-N-(3-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 6-N-(3-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 14836489 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 6-N-(3-phenylpropyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine |
| SMILES | Nc1cccc2c1CCC(NCCCc1ccccc1)C2 |
| InChI | InChI=1S/C19H24N2/c20-19-10-4-9-16-14-17(11-12-18(16)19)21-13-5-8-15-6-2-1-3-7-15/h1-4,6-7,9-10,17,21H,5,8,11-14,20H2 |
| InChIKey | LBTGOEXQKNMRPA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|