C20H26N2 — CID 14836490
6-N-(4-phenylbutyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine (PubChem CID 14836490) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-N-(4-phenylbutyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine.
| Compound Name | 6-N-(4-phenylbutyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 14836490 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 6-N-(4-phenylbutyl)-5,6,7,8-tetrahydronaphthalene-1,6-diamine |
| SMILES | Nc1cccc2c1CCC(NCCCCc1ccccc1)C2 |
| InChI | InChI=1S/C20H26N2/c21-20-11-6-10-17-15-18(12-13-19(17)20)22-14-5-4-9-16-7-2-1-3-8-16/h1-3,6-8,10-11,18,22H,4-5,9,12-15,21H2 |
| InChIKey | FEAHRXUXFOMUEP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|