About N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide
N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 1483698) has the molecular formula C15H9F2N3OS
and a molecular weight of 317.32 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| PubChem CID | 1483698 |
| Molecular Formula | C15H9F2N3OS |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C15H9F2N3OS/c16-10-1-2-12(11(17)7-10)19-14(21)13-8-22-15(20-13)9-3-5-18-6-4-9/h1-8H,(H,19,21) |
| InChIKey | MUZLHKVRLSJOQC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (CID 1483698) is N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide is O=C(Nc1ccc(F)cc1F)c1csc(-c2ccncc2)n1.
What is the InChIKey of N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
The InChIKey is MUZLHKVRLSJOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F2N3OS/c16-10-1-2-12(11(17)7-10)19-14(21)13-8-22-15(20-13)9-3-5-18-6-4-9/h1-8H,(H,19,21).
What are the key properties of N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide?
N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide has a molecular weight of 317.32 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 1483698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).