About 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine
10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine (PubChem CID 1483729) has the molecular formula C14H10N2S
and a molecular weight of 238.32 g/mol. Its IUPAC name is 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine |
| PubChem CID | 1483729 |
| Molecular Formula | C14H10N2S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine |
| SMILES | C#CCN1c2ccccc2Sc2cccnc21 |
| InChI | InChI=1S/C14H10N2S/c1-2-10-16-11-6-3-4-7-12(11)17-13-8-5-9-15-14(13)16/h1,3-9H,10H2 |
| InChIKey | UKEFQPMJYGFDRU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine?
The IUPAC name of 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine (CID 1483729) is 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine.
What is the SMILES notation for 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine?
The canonical SMILES for 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine is C#CCN1c2ccccc2Sc2cccnc21.
What is the InChIKey of 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine?
The InChIKey is UKEFQPMJYGFDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2S/c1-2-10-16-11-6-3-4-7-12(11)17-13-8-5-9-15-14(13)16/h1,3-9H,10H2.
What are the key properties of 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine?
10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine has a molecular weight of 238.32 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-prop-2-ynylpyrido[3,2-b][1,4]benzothiazine is sourced from PubChem (CID 1483729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).