C16H25N3 — CID 14837425
N-methyl-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine (PubChem CID 14837425) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-methyl-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine.
| Compound Name | N-methyl-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine |
|---|---|
| PubChem CID | 14837425 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-methyl-6-propyl-5a,7,8,9,9a,10-hexahydro-5H-pyrido[2,3-g]quinolin-2-amine |
| SMILES | CCCN1CCCC2Cc3nc(NC)ccc3CC21 |
| InChI | InChI=1S/C16H25N3/c1-3-8-19-9-4-5-13-10-14-12(11-15(13)19)6-7-16(17-2)18-14/h6-7,13,15H,3-5,8-11H2,1-2H3,(H,17,18) |
| InChIKey | CYJNWCSYUPWLBA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |