C14H19ClN4O3 — CID 1483777
2-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]ethanone (PubChem CID 1483777) has the molecular formula C14H19ClN4O3 and a molecular weight of 326.78 g/mol. Its IUPAC name is 2-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]ethanone.
| Compound Name | 2-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 1483777 |
| Molecular Formula | C14H19ClN4O3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[4-(6-chloro-2-pyridinyl)piperazin-1-yl]-1-[(4R)-4-hydroxy-1,2-oxazolidin-2-yl]ethanone |
| SMILES | O=C(CN1CCN(c2cccc(Cl)n2)CC1)N1C[C@@H](O)CO1 |
| InChI | InChI=1S/C14H19ClN4O3/c15-12-2-1-3-13(16-12)18-6-4-17(5-7-18)9-14(21)19-8-11(20)10-22-19/h1-3,11,20H,4-10H2/t11-/m1/s1 |
| InChIKey | LMBROFMDQOXBNM-LLVKDONJSA-N |
| XLogP | -0.01 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|