C11H12N2O3S — CID 14837774
4,4-dimethyl-2-(thiadiazole-5-carbonyl)cyclohexane-1,3-dione (PubChem CID 14837774) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 4,4-dimethyl-2-(thiadiazole-5-carbonyl)cyclohexane-1,3-dione.
| Compound Name | 4,4-dimethyl-2-(thiadiazole-5-carbonyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 14837774 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4,4-dimethyl-2-(thiadiazole-5-carbonyl)cyclohexane-1,3-dione |
| SMILES | CC1(C)CCC(=O)C(C(=O)c2cnns2)C1=O |
| InChI | InChI=1S/C11H12N2O3S/c1-11(2)4-3-6(14)8(10(11)16)9(15)7-5-12-13-17-7/h5,8H,3-4H2,1-2H3 |
| InChIKey | WSCOMTCRZMUISS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|