About 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one
3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one (PubChem CID 1483836) has the molecular formula C14H15NO3S
and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one |
| PubChem CID | 1483836 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one |
| SMILES | Cc1cc(C)n(C)c(=O)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO3S/c1-10-9-11(2)15(3)14(16)13(10)19(17,18)12-7-5-4-6-8-12/h4-9H,1-3H3 |
| InChIKey | SPYRBQKPFRPRKB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one?
The IUPAC name of 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one (CID 1483836) is 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one.
What is the SMILES notation for 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one?
The canonical SMILES for 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one is Cc1cc(C)n(C)c(=O)c1S(=O)(=O)c1ccccc1.
What is the InChIKey of 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one?
The InChIKey is SPYRBQKPFRPRKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S/c1-10-9-11(2)15(3)14(16)13(10)19(17,18)12-7-5-4-6-8-12/h4-9H,1-3H3.
What are the key properties of 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one?
3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one has a molecular weight of 277.34 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-1,4,6-trimethylpyridin-2-one is sourced from PubChem (CID 1483836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).