C16H10ClFN4O5 — CID 14839054
2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 14839054) has the molecular formula C16H10ClFN4O5 and a molecular weight of 392.73 g/mol. Its IUPAC name is 2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 14839054 |
| Molecular Formula | C16H10ClFN4O5 |
| Molecular Weight | 392.73 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2-[4-chloro-2-fluoro-5-(4-nitrophenoxy)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(-c2cc(Oc3ccc([N+](=O)[O-])cc3)c(Cl)cc2F)c1=O |
| InChI | InChI=1S/C16H10ClFN4O5/c1-20-15(23)8-19-21(16(20)24)13-7-14(11(17)6-12(13)18)27-10-4-2-9(3-5-10)22(25)26/h2-8H,1H3 |
| InChIKey | ZNACZTPJMQZAMY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|