C20H20FN3O4 — CID 14839369
1-ethyl-6-fluoro-7-[3-(furan-2-yl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 14839369) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-7-[3-(furan-2-yl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-ethyl-6-fluoro-7-[3-(furan-2-yl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14839369 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-ethyl-6-fluoro-7-[3-(furan-2-yl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNC(c4ccco4)C3)cc21 |
| InChI | InChI=1S/C20H20FN3O4/c1-2-23-10-13(20(26)27)19(25)12-8-14(21)17(9-16(12)23)24-6-5-22-15(11-24)18-4-3-7-28-18/h3-4,7-10,15,22H,2,5-6,11H2,1H3,(H,26,27) |
| InChIKey | INXRIJUFWQBJIA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |