About ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate
ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate (PubChem CID 14839833) has the molecular formula C17H22Cl2N2O3
and a molecular weight of 373.28 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate |
| PubChem CID | 14839833 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(OC)(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-6-24-15(22)13-10-17(23-5,16(2,3)4)21(20-13)14-8-7-11(18)9-12(14)19/h7-9H,6,10H2,1-5H3 |
| InChIKey | UNNJFZDRBNIMKO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate?
The IUPAC name of ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate (CID 14839833) is ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate is CCOC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(OC)(C(C)(C)C)C1.
What is the InChIKey of ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate?
The InChIKey is UNNJFZDRBNIMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2N2O3/c1-6-24-15(22)13-10-17(23-5,16(2,3)4)21(20-13)14-8-7-11(18)9-12(14)19/h7-9H,6,10H2,1-5H3.
What are the key properties of ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate?
ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate has a molecular weight of 373.28 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-tert-butyl-1-(2,4-dichlorophenyl)-5-methoxy-4H-pyrazole-3-carboxylate is sourced from PubChem (CID 14839833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).