About ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate
ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate (PubChem CID 14839835) has the molecular formula C16H20Cl2N2O3
and a molecular weight of 359.25 g/mol. Its IUPAC name is ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate |
| PubChem CID | 14839835 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(OC)(C(C)C)C1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-5-23-15(21)13-9-16(22-4,10(2)3)20(19-13)14-7-6-11(17)8-12(14)18/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | DOETWGPERFQJPQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate?
The IUPAC name of ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate (CID 14839835) is ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate?
The canonical SMILES for ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate is CCOC(=O)C1=NN(c2ccc(Cl)cc2Cl)C(OC)(C(C)C)C1.
What is the InChIKey of ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate?
The InChIKey is DOETWGPERFQJPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O3/c1-5-23-15(21)13-9-16(22-4,10(2)3)20(19-13)14-7-6-11(17)8-12(14)18/h6-8,10H,5,9H2,1-4H3.
What are the key properties of ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate?
ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate has a molecular weight of 359.25 g/mol, XLogP of 4.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,4-dichlorophenyl)-5-methoxy-5-propan-2-yl-4H-pyrazole-3-carboxylate is sourced from PubChem (CID 14839835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).