About ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate
ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate (PubChem CID 1484100) has the molecular formula C17H13BrCl2N2O3
and a molecular weight of 444.11 g/mol. Its IUPAC name is ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate |
| PubChem CID | 1484100 |
| Molecular Formula | C17H13BrCl2N2O3 |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(=O)n(Cc2ccc(Cl)c(Cl)c2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C17H13BrCl2N2O3/c1-2-25-17(24)22-15-8-11(18)4-6-14(15)21(16(22)23)9-10-3-5-12(19)13(20)7-10/h3-8H,2,9H2,1H3 |
| InChIKey | FJDCTDALAAFGOL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate?
The IUPAC name of ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate (CID 1484100) is ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate.
What is the SMILES notation for ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate?
The canonical SMILES for ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate is CCOC(=O)n1c(=O)n(Cc2ccc(Cl)c(Cl)c2)c2ccc(Br)cc21.
What is the InChIKey of ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate?
The InChIKey is FJDCTDALAAFGOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrCl2N2O3/c1-2-25-17(24)22-15-8-11(18)4-6-14(15)21(16(22)23)9-10-3-5-12(19)13(20)7-10/h3-8H,2,9H2,1H3.
What are the key properties of ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate?
ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate has a molecular weight of 444.11 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-bromo-3-[(3,4-dichlorophenyl)methyl]-2-oxobenzimidazole-1-carboxylate is sourced from PubChem (CID 1484100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).