About methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate
methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate (PubChem CID 14841012) has the molecular formula C19H35NO2
and a molecular weight of 309.49 g/mol. Its IUPAC name is methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate.
Molecular Properties
| Compound Name | methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate |
| PubChem CID | 14841012 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate |
| SMILES | CCCCCCC1=NC(CCCCCCCC(=O)OC)CC1 |
| InChI | InChI=1S/C19H35NO2/c1-3-4-5-9-12-17-15-16-18(20-17)13-10-7-6-8-11-14-19(21)22-2/h18H,3-16H2,1-2H3 |
| InChIKey | ZJUNFGQINVINHZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate?
The IUPAC name of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate (CID 14841012) is methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate.
What is the SMILES notation for methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate?
The canonical SMILES for methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate is CCCCCCC1=NC(CCCCCCCC(=O)OC)CC1.
What is the InChIKey of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate?
The InChIKey is ZJUNFGQINVINHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO2/c1-3-4-5-9-12-17-15-16-18(20-17)13-10-7-6-8-11-14-19(21)22-2/h18H,3-16H2,1-2H3.
What are the key properties of methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate?
methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate has a molecular weight of 309.49 g/mol, XLogP of 5.46, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-(5-hexyl-3,4-dihydro-2H-pyrrol-2-yl)octanoate is sourced from PubChem (CID 14841012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).