C18H12O3 — CID 14841863
2-phenyl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione (PubChem CID 14841863) has the molecular formula C18H12O3 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-phenyl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 14841863 |
| Molecular Formula | C18H12O3 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-phenyl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES | O=C1C2=C(OC(c3ccccc3)C2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H12O3/c19-16-12-8-4-5-9-13(12)17(20)18-14(16)10-15(21-18)11-6-2-1-3-7-11/h1-9,15H,10H2 |
| InChIKey | ONVBHTYYVYXDIS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|