C9H9N3O2 — CID 14842379
3,7-dimethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione (PubChem CID 14842379) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 3,7-dimethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione.
| Compound Name | 3,7-dimethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
|---|---|
| PubChem CID | 14842379 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 3,7-dimethyl-9H-pyrimido[1,2-a]pyrimidine-2,8-dione |
| SMILES | Cc1cn2cc(C)c(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C9H9N3O2/c1-5-3-12-4-6(2)8(14)11-9(12)10-7(5)13/h3-4H,1-2H3,(H,10,11,13,14) |
| InChIKey | DKPSVDZSCFJQGW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |