About 2,3-dimethoxy-6,7-dimethylquinoxaline
2,3-dimethoxy-6,7-dimethylquinoxaline (PubChem CID 14842752) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 2,3-dimethoxy-6,7-dimethylquinoxaline.
Molecular Properties
| Compound Name | 2,3-dimethoxy-6,7-dimethylquinoxaline |
| PubChem CID | 14842752 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2,3-dimethoxy-6,7-dimethylquinoxaline |
| SMILES | COc1nc2cc(C)c(C)cc2nc1OC |
| InChI | InChI=1S/C12H14N2O2/c1-7-5-9-10(6-8(7)2)14-12(16-4)11(13-9)15-3/h5-6H,1-4H3 |
| InChIKey | MOEBPIYXNBWPEJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethoxy-6,7-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-6,7-dimethylquinoxaline?
The IUPAC name of 2,3-dimethoxy-6,7-dimethylquinoxaline (CID 14842752) is 2,3-dimethoxy-6,7-dimethylquinoxaline.
What is the SMILES notation for 2,3-dimethoxy-6,7-dimethylquinoxaline?
The canonical SMILES for 2,3-dimethoxy-6,7-dimethylquinoxaline is COc1nc2cc(C)c(C)cc2nc1OC.
What is the InChIKey of 2,3-dimethoxy-6,7-dimethylquinoxaline?
The InChIKey is MOEBPIYXNBWPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-7-5-9-10(6-8(7)2)14-12(16-4)11(13-9)15-3/h5-6H,1-4H3.
What are the key properties of 2,3-dimethoxy-6,7-dimethylquinoxaline?
2,3-dimethoxy-6,7-dimethylquinoxaline has a molecular weight of 218.26 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-6,7-dimethylquinoxaline is sourced from PubChem (CID 14842752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).