(2R,3S)-4-amino-2,3-dihydroxybutanoic acid

C4H9NO4 — CID 14844431

IUPAC(2R,3S)-4-amino-2,3-dihydroxybutanoic acid
SMILESNC[C@H](O)[C@@H](O)C(=O)O
InChIInChI=1S/C4H9NO4/c5-1-2(6)3(7)4(8)9/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3+/m0/s1
InChIKeyWITVYMTUWTVRND-STHAYSLISA-N
MW135.12 g/mol
LogP-2.25
Rot. Bonds3

About (2R,3S)-4-amino-2,3-dihydroxybutanoic acid

(2R,3S)-4-amino-2,3-dihydroxybutanoic acid (PubChem CID 14844431) has the molecular formula C4H9NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is (2R,3S)-4-amino-2,3-dihydroxybutanoic acid.

Molecular Properties

Compound Name(2R,3S)-4-amino-2,3-dihydroxybutanoic acid
PubChem CID14844431
Molecular FormulaC4H9NO4
Molecular Weight135.12 g/mol
Exact Mass135.05
IUPAC Name(2R,3S)-4-amino-2,3-dihydroxybutanoic acid
SMILESNC[C@H](O)[C@@H](O)C(=O)O
InChIInChI=1S/C4H9NO4/c5-1-2(6)3(7)4(8)9/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3+/m0/s1
InChIKeyWITVYMTUWTVRND-STHAYSLISA-N
XLogP-2.25
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.12
LogP ≤ 5-2.25
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (2R,3S)-4-amino-2,3-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S)-4-amino-2,3-dihydroxybutanoic acid?
The IUPAC name of (2R,3S)-4-amino-2,3-dihydroxybutanoic acid (CID 14844431) is (2R,3S)-4-amino-2,3-dihydroxybutanoic acid.
What is the SMILES notation for (2R,3S)-4-amino-2,3-dihydroxybutanoic acid?
The canonical SMILES for (2R,3S)-4-amino-2,3-dihydroxybutanoic acid is NC[C@H](O)[C@@H](O)C(=O)O.
What is the InChIKey of (2R,3S)-4-amino-2,3-dihydroxybutanoic acid?
The InChIKey is WITVYMTUWTVRND-STHAYSLISA-N. The full InChI is InChI=1S/C4H9NO4/c5-1-2(6)3(7)4(8)9/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3+/m0/s1.
What are the key properties of (2R,3S)-4-amino-2,3-dihydroxybutanoic acid?
(2R,3S)-4-amino-2,3-dihydroxybutanoic acid has a molecular weight of 135.12 g/mol, XLogP of -2.25, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-4-amino-2,3-dihydroxybutanoic acid is sourced from PubChem (CID 14844431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).