C44H50I2N6 — CID 14844702
2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-5,15-bis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin diiodide (PubChem CID 14844702) has the molecular formula C44H50I2N6 and a molecular weight of 916.73 g/mol. Its IUPAC name is 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-5,15-bis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin diiodide.
| Compound Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-5,15-bis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin diiodide |
|---|---|
| PubChem CID | 14844702 |
| Molecular Formula | C44H50I2N6 |
| Molecular Weight | 916.73 g/mol |
| Exact Mass | 916.22 |
| IUPAC Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-5,15-bis(1-methylpyridin-1-ium-4-yl)-21,22-dihydroporphyrin diiodide |
| SMILES | CCC1=C(C)c2nc1cc1[nH]c(c(C)c1CC)c(-c1cc[n+](C)cc1)c1[nH]c(cc3nc(c2-c2cc[n+](C)cc2)C(C)=C3CC)c(CC)c1C.[I-].[I-] |
| InChI | InChI=1S/C44H49N6.2HI/c1-11-31-25(5)41-39(29-15-19-49(9)20-16-29)42-27(7)33(13-3)37(47-42)24-38-34(14-4)28(8)44(48-38)40(30-17-21-50(10)22-18-30)43-26(6)32(12-2)36(46-43)23-35(31)45-41;;/h15-24H,11-14H2,1-10H3,(H,45,46,47,48);2*1H/q+1;;/p-1/b35-23-,36-23-,37-24-,38-24-,41-39-,42-39-,43-40-,44-40-;; |
| InChIKey | CNIKDLALWVUVMB-MFEFFYHXSA-M |
| XLogP | 3.73 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|