About 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea
1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea (PubChem CID 1484524) has the molecular formula C14H17N3OS
and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea |
| PubChem CID | 1484524 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea |
| SMILES | CC(C)(C)c1csc(NC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H17N3OS/c1-14(2,3)11-9-19-13(16-11)17-12(18)15-10-7-5-4-6-8-10/h4-9H,1-3H3,(H2,15,16,17,18) |
| InChIKey | NGTNSIGGMGZQOJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea?
The IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea (CID 1484524) is 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea.
What is the SMILES notation for 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea?
The canonical SMILES for 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea is CC(C)(C)c1csc(NC(=O)Nc2ccccc2)n1.
What is the InChIKey of 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea?
The InChIKey is NGTNSIGGMGZQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3OS/c1-14(2,3)11-9-19-13(16-11)17-12(18)15-10-7-5-4-6-8-10/h4-9H,1-3H3,(H2,15,16,17,18).
What are the key properties of 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea?
1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea has a molecular weight of 275.38 g/mol, XLogP of 4.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-1,3-thiazol-2-yl)-3-phenylurea is sourced from PubChem (CID 1484524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).