C29H42O5 — CID 14845545
[17-(2-methoxyoxolan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 14845545) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [17-(2-methoxyoxolan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [17-(2-methoxyoxolan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 14845545 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [17-(2-methoxyoxolan-3-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | COC1OCCC1C1CC=C2C1(C)CCC1C3(C)C=CC(=O)C(C)(C)C3CC(OC(C)=O)C21C |
| InChI | InChI=1S/C29H42O5/c1-17(30)34-24-16-22-26(2,3)23(31)11-14-28(22,5)21-10-13-27(4)19(8-9-20(27)29(21,24)6)18-12-15-33-25(18)32-7/h9,11,14,18-19,21-22,24-25H,8,10,12-13,15-16H2,1-7H3 |
| InChIKey | AVHQACOEJHCDEU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|