About 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole
2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole (PubChem CID 1484630) has the molecular formula C11H7ClN2O2S3
and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole |
| PubChem CID | 1484630 |
| Molecular Formula | C11H7ClN2O2S3 |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 329.94 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole |
| SMILES | O=S(=O)(Cc1cnc(Cl)s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H7ClN2O2S3/c12-10-13-5-7(17-10)6-19(15,16)11-14-8-3-1-2-4-9(8)18-11/h1-5H,6H2 |
| InChIKey | BKZZGBSXKBZSBQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole (CID 1484630) is 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole is O=S(=O)(Cc1cnc(Cl)s1)c1nc2ccccc2s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole?
The InChIKey is BKZZGBSXKBZSBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN2O2S3/c12-10-13-5-7(17-10)6-19(15,16)11-14-8-3-1-2-4-9(8)18-11/h1-5H,6H2.
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole?
2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole has a molecular weight of 330.84 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)methylsulfonyl]-1,3-benzothiazole is sourced from PubChem (CID 1484630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).