C43H49F3O6 — CID 14847576
6-O-[4-(4-decoxycarbonylphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate (PubChem CID 14847576) has the molecular formula C43H49F3O6 and a molecular weight of 718.85 g/mol. Its IUPAC name is 6-O-[4-(4-decoxycarbonylphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate.
| Compound Name | 6-O-[4-(4-decoxycarbonylphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 14847576 |
| Molecular Formula | C43H49F3O6 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | 6-O-[4-(4-decoxycarbonylphenyl)phenyl] 2-O-(1,1,1-trifluorooctan-2-yl) naphthalene-2,6-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(-c2ccc(OC(=O)c3ccc4cc(C(=O)OC(CCCCCC)C(F)(F)F)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C43H49F3O6/c1-3-5-7-9-10-11-12-14-28-50-40(47)33-18-16-31(17-19-33)32-24-26-38(27-25-32)51-41(48)36-22-20-35-30-37(23-21-34(35)29-36)42(49)52-39(43(44,45)46)15-13-8-6-4-2/h16-27,29-30,39H,3-15,28H2,1-2H3 |
| InChIKey | XDHYDKNFQIZHRF-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|